C15H21Cl2N3O2 — CID 119454929
2-(4-chlorophenyl)-N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)acetamide;hydrochloride (PubChem CID 119454929) has the molecular formula C15H21Cl2N3O2 and a molecular weight of 346.26 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)acetamide;hydrochloride.
| Compound Name | 2-(4-chlorophenyl)-N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119454929 |
| Molecular Formula | C15H21Cl2N3O2 |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 2-(4-chlorophenyl)-N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)acetamide;hydrochloride |
| SMILES | CN(CC(=O)N1CCNCC1)C(=O)Cc1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C15H20ClN3O2.ClH/c1-18(11-15(21)19-8-6-17-7-9-19)14(20)10-12-2-4-13(16)5-3-12;/h2-5,17H,6-11H2,1H3;1H |
| InChIKey | JKSNZGCAFVFPFM-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |