C16H28N2O — CID 64952136
3-tert-butyl-1-[1-(2,5-dimethylfuran-3-yl)ethyl]piperazine (PubChem CID 64952136) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is 3-tert-butyl-1-[1-(2,5-dimethylfuran-3-yl)ethyl]piperazine.
| Compound Name | 3-tert-butyl-1-[1-(2,5-dimethylfuran-3-yl)ethyl]piperazine |
|---|---|
| PubChem CID | 64952136 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | 3-tert-butyl-1-[1-(2,5-dimethylfuran-3-yl)ethyl]piperazine |
| SMILES | Cc1cc(C(C)N2CCNC(C(C)(C)C)C2)c(C)o1 |
| InChI | InChI=1S/C16H28N2O/c1-11-9-14(13(3)19-11)12(2)18-8-7-17-15(10-18)16(4,5)6/h9,12,15,17H,7-8,10H2,1-6H3 |
| InChIKey | OKPUYYSBOYOADO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |