C19H30N2 — CID 64952857
3-benzyl-1-(3,4-dimethylcyclohexyl)piperazine (PubChem CID 64952857) has the molecular formula C19H30N2 and a molecular weight of 286.46 g/mol. Its IUPAC name is 3-benzyl-1-(3,4-dimethylcyclohexyl)piperazine.
| Compound Name | 3-benzyl-1-(3,4-dimethylcyclohexyl)piperazine |
|---|---|
| PubChem CID | 64952857 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | 3-benzyl-1-(3,4-dimethylcyclohexyl)piperazine |
| SMILES | CC1CCC(N2CCNC(Cc3ccccc3)C2)CC1C |
| InChI | InChI=1S/C19H30N2/c1-15-8-9-19(12-16(15)2)21-11-10-20-18(14-21)13-17-6-4-3-5-7-17/h3-7,15-16,18-20H,8-14H2,1-2H3 |
| InChIKey | SOQKUMSNKVZKLD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |