C16H24N2O2S — CID 64944072
3-(3-benzyl-1,4-diazepan-1-yl)thiolane 1,1-dioxide (PubChem CID 64944072) has the molecular formula C16H24N2O2S and a molecular weight of 308.45 g/mol. Its IUPAC name is 3-(3-benzyl-1,4-diazepan-1-yl)thiolane 1,1-dioxide.
| Compound Name | 3-(3-benzyl-1,4-diazepan-1-yl)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 64944072 |
| Molecular Formula | C16H24N2O2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 3-(3-benzyl-1,4-diazepan-1-yl)thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(N2CCCNC(Cc3ccccc3)C2)C1 |
| InChI | InChI=1S/C16H24N2O2S/c19-21(20)10-7-16(13-21)18-9-4-8-17-15(12-18)11-14-5-2-1-3-6-14/h1-3,5-6,15-17H,4,7-13H2 |
| InChIKey | ABHVWKORUCSKSV-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |