C15H25N3S — CID 64953406
2-[2-(3-cyclohexylpiperazin-1-yl)ethyl]-1,3-thiazole (PubChem CID 64953406) has the molecular formula C15H25N3S and a molecular weight of 279.45 g/mol. Its IUPAC name is 2-[2-(3-cyclohexylpiperazin-1-yl)ethyl]-1,3-thiazole.
| Compound Name | 2-[2-(3-cyclohexylpiperazin-1-yl)ethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 64953406 |
| Molecular Formula | C15H25N3S |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 2-[2-(3-cyclohexylpiperazin-1-yl)ethyl]-1,3-thiazole |
| SMILES | c1csc(CCN2CCNC(C3CCCCC3)C2)n1 |
| InChI | InChI=1S/C15H25N3S/c1-2-4-13(5-3-1)14-12-18(10-7-16-14)9-6-15-17-8-11-19-15/h8,11,13-14,16H,1-7,9-10,12H2 |
| InChIKey | AJKQTOUBSWJVAY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |