C17H30N4 — CID 64870713
3-cyclohexyl-1-[2-(2-methylimidazol-1-yl)ethyl]-1,4-diazepane (PubChem CID 64870713) has the molecular formula C17H30N4 and a molecular weight of 290.45 g/mol. Its IUPAC name is 3-cyclohexyl-1-[2-(2-methylimidazol-1-yl)ethyl]-1,4-diazepane.
| Compound Name | 3-cyclohexyl-1-[2-(2-methylimidazol-1-yl)ethyl]-1,4-diazepane |
|---|---|
| PubChem CID | 64870713 |
| Molecular Formula | C17H30N4 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | 3-cyclohexyl-1-[2-(2-methylimidazol-1-yl)ethyl]-1,4-diazepane |
| SMILES | Cc1nccn1CCN1CCCNC(C2CCCCC2)C1 |
| InChI | InChI=1S/C17H30N4/c1-15-18-9-11-21(15)13-12-20-10-5-8-19-17(14-20)16-6-3-2-4-7-16/h9,11,16-17,19H,2-8,10,12-14H2,1H3 |
| InChIKey | GGNIBEFODAFTRA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |