C14H24N4O — CID 106408595
3-[(3-cyclohexyl-1,4-diazepan-1-yl)methyl]-1,2,4-oxadiazole (PubChem CID 106408595) has the molecular formula C14H24N4O and a molecular weight of 264.37 g/mol. Its IUPAC name is 3-[(3-cyclohexyl-1,4-diazepan-1-yl)methyl]-1,2,4-oxadiazole.
| Compound Name | 3-[(3-cyclohexyl-1,4-diazepan-1-yl)methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 106408595 |
| Molecular Formula | C14H24N4O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | 3-[(3-cyclohexyl-1,4-diazepan-1-yl)methyl]-1,2,4-oxadiazole |
| SMILES | c1nc(CN2CCCNC(C3CCCCC3)C2)no1 |
| InChI | InChI=1S/C14H24N4O/c1-2-5-12(6-3-1)13-9-18(8-4-7-15-13)10-14-16-11-19-17-14/h11-13,15H,1-10H2 |
| InChIKey | XXZLIPHJJSQWRP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |