C9H14N4O2 — CID 123875795
N-[1-(1,2,4-oxadiazol-3-ylmethyl)piperidin-3-yl]formamide (PubChem CID 123875795) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is N-[1-(1,2,4-oxadiazol-3-ylmethyl)piperidin-3-yl]formamide.
| Compound Name | N-[1-(1,2,4-oxadiazol-3-ylmethyl)piperidin-3-yl]formamide |
|---|---|
| PubChem CID | 123875795 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | N-[1-(1,2,4-oxadiazol-3-ylmethyl)piperidin-3-yl]formamide |
| SMILES | O=CNC1CCCN(Cc2ncon2)C1 |
| InChI | InChI=1S/C9H14N4O2/c14-6-10-8-2-1-3-13(4-8)5-9-11-7-15-12-9/h6-8H,1-5H2,(H,10,14) |
| InChIKey | ZEURZCUHURZLJT-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|