C16H20N2O2 — CID 64957081
3-methyl-1-(5,6,7,8-tetrahydronaphthalen-1-yl)-1,4-diazepane-2,5-dione (PubChem CID 64957081) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 3-methyl-1-(5,6,7,8-tetrahydronaphthalen-1-yl)-1,4-diazepane-2,5-dione.
| Compound Name | 3-methyl-1-(5,6,7,8-tetrahydronaphthalen-1-yl)-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 64957081 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 3-methyl-1-(5,6,7,8-tetrahydronaphthalen-1-yl)-1,4-diazepane-2,5-dione |
| SMILES | CC1NC(=O)CCN(c2cccc3c2CCCC3)C1=O |
| InChI | InChI=1S/C16H20N2O2/c1-11-16(20)18(10-9-15(19)17-11)14-8-4-6-12-5-2-3-7-13(12)14/h4,6,8,11H,2-3,5,7,9-10H2,1H3,(H,17,19) |
| InChIKey | MVSXLRBLZSIQHF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |