C13H14F2N2O2 — CID 64957903
1-(2,4-difluorophenyl)-3-propan-2-ylpiperazine-2,5-dione (PubChem CID 64957903) has the molecular formula C13H14F2N2O2 and a molecular weight of 268.26 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-propan-2-ylpiperazine-2,5-dione.
| Compound Name | 1-(2,4-difluorophenyl)-3-propan-2-ylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 64957903 |
| Molecular Formula | C13H14F2N2O2 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-propan-2-ylpiperazine-2,5-dione |
| SMILES | CC(C)C1NC(=O)CN(c2ccc(F)cc2F)C1=O |
| InChI | InChI=1S/C13H14F2N2O2/c1-7(2)12-13(19)17(6-11(18)16-12)10-4-3-8(14)5-9(10)15/h3-5,7,12H,6H2,1-2H3,(H,16,18) |
| InChIKey | OHBBLNDPAVHVOV-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |