C14H13Cl3N2O2 — CID 64962108
3-cyclopropyl-3-methyl-1-(2,4,5-trichlorophenyl)piperazine-2,5-dione (PubChem CID 64962108) has the molecular formula C14H13Cl3N2O2 and a molecular weight of 347.63 g/mol. Its IUPAC name is 3-cyclopropyl-3-methyl-1-(2,4,5-trichlorophenyl)piperazine-2,5-dione.
| Compound Name | 3-cyclopropyl-3-methyl-1-(2,4,5-trichlorophenyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 64962108 |
| Molecular Formula | C14H13Cl3N2O2 |
| Molecular Weight | 347.63 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | 3-cyclopropyl-3-methyl-1-(2,4,5-trichlorophenyl)piperazine-2,5-dione |
| SMILES | CC1(C2CC2)NC(=O)CN(c2cc(Cl)c(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C14H13Cl3N2O2/c1-14(7-2-3-7)13(21)19(6-12(20)18-14)11-5-9(16)8(15)4-10(11)17/h4-5,7H,2-3,6H2,1H3,(H,18,20) |
| InChIKey | XRHOUBXSWOMRJR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.63 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|