C14H13Cl2FN2O2 — CID 107580238
3-cyclopropyl-1-(3,5-dichloro-4-fluorophenyl)-3-methylpiperazine-2,5-dione (PubChem CID 107580238) has the molecular formula C14H13Cl2FN2O2 and a molecular weight of 331.17 g/mol. Its IUPAC name is 3-cyclopropyl-1-(3,5-dichloro-4-fluorophenyl)-3-methylpiperazine-2,5-dione.
| Compound Name | 3-cyclopropyl-1-(3,5-dichloro-4-fluorophenyl)-3-methylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 107580238 |
| Molecular Formula | C14H13Cl2FN2O2 |
| Molecular Weight | 331.17 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 3-cyclopropyl-1-(3,5-dichloro-4-fluorophenyl)-3-methylpiperazine-2,5-dione |
| SMILES | CC1(C2CC2)NC(=O)CN(c2cc(Cl)c(F)c(Cl)c2)C1=O |
| InChI | InChI=1S/C14H13Cl2FN2O2/c1-14(7-2-3-7)13(21)19(6-11(20)18-14)8-4-9(15)12(17)10(16)5-8/h4-5,7H,2-3,6H2,1H3,(H,18,20) |
| InChIKey | JYVCDFZUVSYZNV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.17 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|