C15H19IN2O2 — CID 64962688
1-(3-iodophenyl)-3-(2-methylpropyl)-1,4-diazepane-2,5-dione (PubChem CID 64962688) has the molecular formula C15H19IN2O2 and a molecular weight of 386.23 g/mol. Its IUPAC name is 1-(3-iodophenyl)-3-(2-methylpropyl)-1,4-diazepane-2,5-dione.
| Compound Name | 1-(3-iodophenyl)-3-(2-methylpropyl)-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 64962688 |
| Molecular Formula | C15H19IN2O2 |
| Molecular Weight | 386.23 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | 1-(3-iodophenyl)-3-(2-methylpropyl)-1,4-diazepane-2,5-dione |
| SMILES | CC(C)CC1NC(=O)CCN(c2cccc(I)c2)C1=O |
| InChI | InChI=1S/C15H19IN2O2/c1-10(2)8-13-15(20)18(7-6-14(19)17-13)12-5-3-4-11(16)9-12/h3-5,9-10,13H,6-8H2,1-2H3,(H,17,19) |
| InChIKey | VFPNXGZBVDDNEH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.23 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|