C14H15IN2O2 — CID 64962833
3-cyclopropyl-1-(3-iodophenyl)-1,4-diazepane-2,5-dione (PubChem CID 64962833) has the molecular formula C14H15IN2O2 and a molecular weight of 370.19 g/mol. Its IUPAC name is 3-cyclopropyl-1-(3-iodophenyl)-1,4-diazepane-2,5-dione.
| Compound Name | 3-cyclopropyl-1-(3-iodophenyl)-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 64962833 |
| Molecular Formula | C14H15IN2O2 |
| Molecular Weight | 370.19 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | 3-cyclopropyl-1-(3-iodophenyl)-1,4-diazepane-2,5-dione |
| SMILES | O=C1CCN(c2cccc(I)c2)C(=O)C(C2CC2)N1 |
| InChI | InChI=1S/C14H15IN2O2/c15-10-2-1-3-11(8-10)17-7-6-12(18)16-13(14(17)19)9-4-5-9/h1-3,8-9,13H,4-7H2,(H,16,18) |
| InChIKey | MXIJHBVDYQASGF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.19 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|