C13H15IN2O2 — CID 64962699
1-(4-iodophenyl)-3-propan-2-ylpiperazine-2,5-dione (PubChem CID 64962699) has the molecular formula C13H15IN2O2 and a molecular weight of 358.18 g/mol. Its IUPAC name is 1-(4-iodophenyl)-3-propan-2-ylpiperazine-2,5-dione.
| Compound Name | 1-(4-iodophenyl)-3-propan-2-ylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 64962699 |
| Molecular Formula | C13H15IN2O2 |
| Molecular Weight | 358.18 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 1-(4-iodophenyl)-3-propan-2-ylpiperazine-2,5-dione |
| SMILES | CC(C)C1NC(=O)CN(c2ccc(I)cc2)C1=O |
| InChI | InChI=1S/C13H15IN2O2/c1-8(2)12-13(18)16(7-11(17)15-12)10-5-3-9(14)4-6-10/h3-6,8,12H,7H2,1-2H3,(H,15,17) |
| InChIKey | WZQXGPVEKLQNPN-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.18 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|