C14H14N2O2 — CID 64963667
6-methyl-3-phenyl-1-prop-2-ynylpiperazine-2,5-dione (PubChem CID 64963667) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 6-methyl-3-phenyl-1-prop-2-ynylpiperazine-2,5-dione.
| Compound Name | 6-methyl-3-phenyl-1-prop-2-ynylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 64963667 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 6-methyl-3-phenyl-1-prop-2-ynylpiperazine-2,5-dione |
| SMILES | C#CCN1C(=O)C(c2ccccc2)NC(=O)C1C |
| InChI | InChI=1S/C14H14N2O2/c1-3-9-16-10(2)13(17)15-12(14(16)18)11-7-5-4-6-8-11/h1,4-8,10,12H,9H2,2H3,(H,15,17) |
| InChIKey | CKLTUSIGGHKJRE-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|