C14H20N2O3 — CID 64964726
3-tert-butyl-1-[2-(furan-2-yl)ethyl]piperazine-2,5-dione (PubChem CID 64964726) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 3-tert-butyl-1-[2-(furan-2-yl)ethyl]piperazine-2,5-dione.
| Compound Name | 3-tert-butyl-1-[2-(furan-2-yl)ethyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 64964726 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 3-tert-butyl-1-[2-(furan-2-yl)ethyl]piperazine-2,5-dione |
| SMILES | CC(C)(C)C1NC(=O)CN(CCc2ccco2)C1=O |
| InChI | InChI=1S/C14H20N2O3/c1-14(2,3)12-13(18)16(9-11(17)15-12)7-6-10-5-4-8-19-10/h4-5,8,12H,6-7,9H2,1-3H3,(H,15,17) |
| InChIKey | XDMOJZIGBBZOGG-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |