About 1-(4-chloro-2-fluorophenyl)-3-cyclopropyl-3,6-dimethylpiperazine-2,5-dione
1-(4-chloro-2-fluorophenyl)-3-cyclopropyl-3,6-dimethylpiperazine-2,5-dione (PubChem CID 64965252) has the molecular formula C15H16ClFN2O2
and a molecular weight of 310.76 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)-3-cyclopropyl-3,6-dimethylpiperazine-2,5-dione.
Molecular Properties
| Compound Name | 1-(4-chloro-2-fluorophenyl)-3-cyclopropyl-3,6-dimethylpiperazine-2,5-dione |
| PubChem CID | 64965252 |
| Molecular Formula | C15H16ClFN2O2 |
| Molecular Weight | 310.76 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)-3-cyclopropyl-3,6-dimethylpiperazine-2,5-dione |
| SMILES | CC1C(=O)NC(C)(C2CC2)C(=O)N1c1ccc(Cl)cc1F |
| InChI | InChI=1S/C15H16ClFN2O2/c1-8-13(20)18-15(2,9-3-4-9)14(21)19(8)12-6-5-10(16)7-11(12)17/h5-9H,3-4H2,1-2H3,(H,18,20) |
| InChIKey | LEZUQEOVKAYGHX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.76 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-chloro-2-fluorophenyl)-3-cyclopropyl-3,6-dimethylpiperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chloro-2-fluorophenyl)-3-cyclopropyl-3,6-dimethylpiperazine-2,5-dione?
The IUPAC name of 1-(4-chloro-2-fluorophenyl)-3-cyclopropyl-3,6-dimethylpiperazine-2,5-dione (CID 64965252) is 1-(4-chloro-2-fluorophenyl)-3-cyclopropyl-3,6-dimethylpiperazine-2,5-dione.
What is the SMILES notation for 1-(4-chloro-2-fluorophenyl)-3-cyclopropyl-3,6-dimethylpiperazine-2,5-dione?
The canonical SMILES for 1-(4-chloro-2-fluorophenyl)-3-cyclopropyl-3,6-dimethylpiperazine-2,5-dione is CC1C(=O)NC(C)(C2CC2)C(=O)N1c1ccc(Cl)cc1F.
What is the InChIKey of 1-(4-chloro-2-fluorophenyl)-3-cyclopropyl-3,6-dimethylpiperazine-2,5-dione?
The InChIKey is LEZUQEOVKAYGHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16ClFN2O2/c1-8-13(20)18-15(2,9-3-4-9)14(21)19(8)12-6-5-10(16)7-11(12)17/h5-9H,3-4H2,1-2H3,(H,18,20).
What are the key properties of 1-(4-chloro-2-fluorophenyl)-3-cyclopropyl-3,6-dimethylpiperazine-2,5-dione?
1-(4-chloro-2-fluorophenyl)-3-cyclopropyl-3,6-dimethylpiperazine-2,5-dione has a molecular weight of 310.76 g/mol, XLogP of 2.50, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chloro-2-fluorophenyl)-3-cyclopropyl-3,6-dimethylpiperazine-2,5-dione is sourced from PubChem (CID 64965252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).