C15H16Br2N2O2 — CID 64965325
3-cyclopropyl-1-(2,4-dibromophenyl)-3-methyl-1,4-diazepane-2,5-dione (PubChem CID 64965325) has the molecular formula C15H16Br2N2O2 and a molecular weight of 416.11 g/mol. Its IUPAC name is 3-cyclopropyl-1-(2,4-dibromophenyl)-3-methyl-1,4-diazepane-2,5-dione.
| Compound Name | 3-cyclopropyl-1-(2,4-dibromophenyl)-3-methyl-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 64965325 |
| Molecular Formula | C15H16Br2N2O2 |
| Molecular Weight | 416.11 g/mol |
| Exact Mass | 413.96 |
| IUPAC Name | 3-cyclopropyl-1-(2,4-dibromophenyl)-3-methyl-1,4-diazepane-2,5-dione |
| SMILES | CC1(C2CC2)NC(=O)CCN(c2ccc(Br)cc2Br)C1=O |
| InChI | InChI=1S/C15H16Br2N2O2/c1-15(9-2-3-9)14(21)19(7-6-13(20)18-15)12-5-4-10(16)8-11(12)17/h4-5,8-9H,2-3,6-7H2,1H3,(H,18,20) |
| InChIKey | JLXDTOKCTCWLSI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.11 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |