C15H25N3O2 — CID 64966584
6-ethyl-1-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-3,3-dimethylpiperazine-2,5-dione (PubChem CID 64966584) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is 6-ethyl-1-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-3,3-dimethylpiperazine-2,5-dione.
| Compound Name | 6-ethyl-1-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-3,3-dimethylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 64966584 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | 6-ethyl-1-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-3,3-dimethylpiperazine-2,5-dione |
| SMILES | CCC1C(=O)NC(C)(C)C(=O)N1C1CCN2CCCC12 |
| InChI | InChI=1S/C15H25N3O2/c1-4-10-13(19)16-15(2,3)14(20)18(10)12-7-9-17-8-5-6-11(12)17/h10-12H,4-9H2,1-3H3,(H,16,19) |
| InChIKey | LJHBPIJKFINEGX-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |