C16H27N3O2 — CID 64966696
1-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-3,6-diethylpiperazine-2,5-dione (PubChem CID 64966696) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-3,6-diethylpiperazine-2,5-dione.
| Compound Name | 1-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-3,6-diethylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 64966696 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 1-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-3,6-diethylpiperazine-2,5-dione |
| SMILES | CCC1NC(=O)C(CC)N(C2CCN3CCCCC23)C1=O |
| InChI | InChI=1S/C16H27N3O2/c1-3-11-16(21)19(12(4-2)15(20)17-11)14-8-10-18-9-6-5-7-13(14)18/h11-14H,3-10H2,1-2H3,(H,17,20) |
| InChIKey | WLZUMYJGCRBVHS-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |