C13H20N2O2 — CID 64972499
1-but-3-ynyl-3,3-dimethyl-6-propan-2-ylpiperazine-2,5-dione (PubChem CID 64972499) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 1-but-3-ynyl-3,3-dimethyl-6-propan-2-ylpiperazine-2,5-dione.
| Compound Name | 1-but-3-ynyl-3,3-dimethyl-6-propan-2-ylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 64972499 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 1-but-3-ynyl-3,3-dimethyl-6-propan-2-ylpiperazine-2,5-dione |
| SMILES | C#CCCN1C(=O)C(C)(C)NC(=O)C1C(C)C |
| InChI | InChI=1S/C13H20N2O2/c1-6-7-8-15-10(9(2)3)11(16)14-13(4,5)12(15)17/h1,9-10H,7-8H2,2-5H3,(H,14,16) |
| InChIKey | WBXMTBHQUNDYBB-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|