C17H20N2O2 — CID 106222095
3,3-dimethyl-1-pent-4-ynyl-6-phenylpiperazine-2,5-dione (PubChem CID 106222095) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 3,3-dimethyl-1-pent-4-ynyl-6-phenylpiperazine-2,5-dione.
| Compound Name | 3,3-dimethyl-1-pent-4-ynyl-6-phenylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 106222095 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 3,3-dimethyl-1-pent-4-ynyl-6-phenylpiperazine-2,5-dione |
| SMILES | C#CCCCN1C(=O)C(C)(C)NC(=O)C1c1ccccc1 |
| InChI | InChI=1S/C17H20N2O2/c1-4-5-9-12-19-14(13-10-7-6-8-11-13)15(20)18-17(2,3)16(19)21/h1,6-8,10-11,14H,5,9,12H2,2-3H3,(H,18,20) |
| InChIKey | LESZKICGMMHQMP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|