C13H20N2O2 — CID 114160161
3-ethyl-3,6-dimethyl-1-pent-4-ynylpiperazine-2,5-dione (PubChem CID 114160161) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 3-ethyl-3,6-dimethyl-1-pent-4-ynylpiperazine-2,5-dione.
| Compound Name | 3-ethyl-3,6-dimethyl-1-pent-4-ynylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 114160161 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 3-ethyl-3,6-dimethyl-1-pent-4-ynylpiperazine-2,5-dione |
| SMILES | C#CCCCN1C(=O)C(C)(CC)NC(=O)C1C |
| InChI | InChI=1S/C13H20N2O2/c1-5-7-8-9-15-10(3)11(16)14-13(4,6-2)12(15)17/h1,10H,6-9H2,2-4H3,(H,14,16) |
| InChIKey | WDSGOBKCSSUVSV-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|