C17H20N2O2 — CID 106222106
3-methyl-1-pent-4-ynyl-3-phenyl-1,4-diazepane-2,5-dione (PubChem CID 106222106) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 3-methyl-1-pent-4-ynyl-3-phenyl-1,4-diazepane-2,5-dione.
| Compound Name | 3-methyl-1-pent-4-ynyl-3-phenyl-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 106222106 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 3-methyl-1-pent-4-ynyl-3-phenyl-1,4-diazepane-2,5-dione |
| SMILES | C#CCCCN1CCC(=O)NC(C)(c2ccccc2)C1=O |
| InChI | InChI=1S/C17H20N2O2/c1-3-4-8-12-19-13-11-15(20)18-17(2,16(19)21)14-9-6-5-7-10-14/h1,5-7,9-10H,4,8,11-13H2,2H3,(H,18,20) |
| InChIKey | RJZFJBZLAOEJJM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|