C13H19N3O2S — CID 64973279
3,6-diethyl-1-[1-(1,3-thiazol-2-yl)ethyl]piperazine-2,5-dione (PubChem CID 64973279) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is 3,6-diethyl-1-[1-(1,3-thiazol-2-yl)ethyl]piperazine-2,5-dione.
| Compound Name | 3,6-diethyl-1-[1-(1,3-thiazol-2-yl)ethyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 64973279 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 3,6-diethyl-1-[1-(1,3-thiazol-2-yl)ethyl]piperazine-2,5-dione |
| SMILES | CCC1NC(=O)C(CC)N(C(C)c2nccs2)C1=O |
| InChI | InChI=1S/C13H19N3O2S/c1-4-9-13(18)16(10(5-2)11(17)15-9)8(3)12-14-6-7-19-12/h6-10H,4-5H2,1-3H3,(H,15,17) |
| InChIKey | SCSPXWNKQBZPSW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |