C16H21BrN2O2 — CID 64965367
1-[1-(4-bromophenyl)ethyl]-3,6-diethylpiperazine-2,5-dione (PubChem CID 64965367) has the molecular formula C16H21BrN2O2 and a molecular weight of 353.26 g/mol. Its IUPAC name is 1-[1-(4-bromophenyl)ethyl]-3,6-diethylpiperazine-2,5-dione.
| Compound Name | 1-[1-(4-bromophenyl)ethyl]-3,6-diethylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 64965367 |
| Molecular Formula | C16H21BrN2O2 |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 1-[1-(4-bromophenyl)ethyl]-3,6-diethylpiperazine-2,5-dione |
| SMILES | CCC1NC(=O)C(CC)N(C(C)c2ccc(Br)cc2)C1=O |
| InChI | InChI=1S/C16H21BrN2O2/c1-4-13-16(21)19(14(5-2)15(20)18-13)10(3)11-6-8-12(17)9-7-11/h6-10,13-14H,4-5H2,1-3H3,(H,18,20) |
| InChIKey | JPUGIJBKFIKXMD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |