C13H12FNOS — CID 64976587
2-(3-fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-ol (PubChem CID 64976587) has the molecular formula C13H12FNOS and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-ol.
| Compound Name | 2-(3-fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-ol |
|---|---|
| PubChem CID | 64976587 |
| Molecular Formula | C13H12FNOS |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 2-(3-fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-ol |
| SMILES | OC1CCCc2sc(-c3cccc(F)c3)nc21 |
| InChI | InChI=1S/C13H12FNOS/c14-9-4-1-3-8(7-9)13-15-12-10(16)5-2-6-11(12)17-13/h1,3-4,7,10,16H,2,5-6H2 |
| InChIKey | WRVFSROIEGKLMH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |