C13H10F3NOS — CID 64976625
2-(3,4,5-trifluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-ol (PubChem CID 64976625) has the molecular formula C13H10F3NOS and a molecular weight of 285.29 g/mol. Its IUPAC name is 2-(3,4,5-trifluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-ol.
| Compound Name | 2-(3,4,5-trifluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-ol |
|---|---|
| PubChem CID | 64976625 |
| Molecular Formula | C13H10F3NOS |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 2-(3,4,5-trifluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-ol |
| SMILES | OC1CCCc2sc(-c3cc(F)c(F)c(F)c3)nc21 |
| InChI | InChI=1S/C13H10F3NOS/c14-7-4-6(5-8(15)11(7)16)13-17-12-9(18)2-1-3-10(12)19-13/h4-5,9,18H,1-3H2 |
| InChIKey | RTPZAUMBYRQFCC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|