C14H13NO — CID 649766
8-methyl-5,6-dihydrobenzo[b][1,4]benzoxazepine (PubChem CID 649766) has the molecular formula C14H13NO and a molecular weight of 211.26 g/mol. Its IUPAC name is 8-methyl-5,6-dihydrobenzo[b][1,4]benzoxazepine.
| Compound Name | 8-methyl-5,6-dihydrobenzo[b][1,4]benzoxazepine |
|---|---|
| PubChem CID | 649766 |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 8-methyl-5,6-dihydrobenzo[b][1,4]benzoxazepine |
| SMILES | Cc1ccc2c(c1)CNc1ccccc1O2 |
| InChI | InChI=1S/C14H13NO/c1-10-6-7-13-11(8-10)9-15-12-4-2-3-5-14(12)16-13/h2-8,15H,9H2,1H3 |
| InChIKey | NCEYQLGZLWZIPV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |