C14H21N5S — CID 64977033
2-N,4-N-dimethyl-2-N-[(1-methylpyrazol-4-yl)methyl]-4,5,6,7-tetrahydro-1,3-benzothiazole-2,4-diamine (PubChem CID 64977033) has the molecular formula C14H21N5S and a molecular weight of 291.42 g/mol. Its IUPAC name is 2-N,4-N-dimethyl-2-N-[(1-methylpyrazol-4-yl)methyl]-4,5,6,7-tetrahydro-1,3-benzothiazole-2,4-diamine.
| Compound Name | 2-N,4-N-dimethyl-2-N-[(1-methylpyrazol-4-yl)methyl]-4,5,6,7-tetrahydro-1,3-benzothiazole-2,4-diamine |
|---|---|
| PubChem CID | 64977033 |
| Molecular Formula | C14H21N5S |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 2-N,4-N-dimethyl-2-N-[(1-methylpyrazol-4-yl)methyl]-4,5,6,7-tetrahydro-1,3-benzothiazole-2,4-diamine |
| SMILES | CNC1CCCc2sc(N(C)Cc3cnn(C)c3)nc21 |
| InChI | InChI=1S/C14H21N5S/c1-15-11-5-4-6-12-13(11)17-14(20-12)18(2)8-10-7-16-19(3)9-10/h7,9,11,15H,4-6,8H2,1-3H3 |
| InChIKey | OLHFBHSPMAYOEG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |