C14H23N3O2S2 — CID 64977204
2-N-(1,1-dioxothiolan-3-yl)-4-N-ethyl-2-N-methyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,4-diamine (PubChem CID 64977204) has the molecular formula C14H23N3O2S2 and a molecular weight of 329.49 g/mol. Its IUPAC name is 2-N-(1,1-dioxothiolan-3-yl)-4-N-ethyl-2-N-methyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,4-diamine.
| Compound Name | 2-N-(1,1-dioxothiolan-3-yl)-4-N-ethyl-2-N-methyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,4-diamine |
|---|---|
| PubChem CID | 64977204 |
| Molecular Formula | C14H23N3O2S2 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 2-N-(1,1-dioxothiolan-3-yl)-4-N-ethyl-2-N-methyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,4-diamine |
| SMILES | CCNC1CCCc2sc(N(C)C3CCS(=O)(=O)C3)nc21 |
| InChI | InChI=1S/C14H23N3O2S2/c1-3-15-11-5-4-6-12-13(11)16-14(20-12)17(2)10-7-8-21(18,19)9-10/h10-11,15H,3-9H2,1-2H3 |
| InChIKey | QEOKFSGCUGJNJN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |