C15H27N3OS — CID 64977301
2-N,4-N-diethyl-2-N-(1-methoxypropan-2-yl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,4-diamine (PubChem CID 64977301) has the molecular formula C15H27N3OS and a molecular weight of 297.47 g/mol. Its IUPAC name is 2-N,4-N-diethyl-2-N-(1-methoxypropan-2-yl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,4-diamine.
| Compound Name | 2-N,4-N-diethyl-2-N-(1-methoxypropan-2-yl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,4-diamine |
|---|---|
| PubChem CID | 64977301 |
| Molecular Formula | C15H27N3OS |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 2-N,4-N-diethyl-2-N-(1-methoxypropan-2-yl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,4-diamine |
| SMILES | CCNC1CCCc2sc(N(CC)C(C)COC)nc21 |
| InChI | InChI=1S/C15H27N3OS/c1-5-16-12-8-7-9-13-14(12)17-15(20-13)18(6-2)11(3)10-19-4/h11-12,16H,5-10H2,1-4H3 |
| InChIKey | ZNBPAHLQILWIHX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |