C14H22N4O2 — CID 64979051
methyl 6-(2,5-diethylpiperazin-1-yl)pyridazine-3-carboxylate (PubChem CID 64979051) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is methyl 6-(2,5-diethylpiperazin-1-yl)pyridazine-3-carboxylate.
| Compound Name | methyl 6-(2,5-diethylpiperazin-1-yl)pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 64979051 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | methyl 6-(2,5-diethylpiperazin-1-yl)pyridazine-3-carboxylate |
| SMILES | CCC1CN(c2ccc(C(=O)OC)nn2)C(CC)CN1 |
| InChI | InChI=1S/C14H22N4O2/c1-4-10-9-18(11(5-2)8-15-10)13-7-6-12(16-17-13)14(19)20-3/h6-7,10-11,15H,4-5,8-9H2,1-3H3 |
| InChIKey | GCRBSPOACHLBOP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |