C10H18N2O — CID 64980060
(E)-1-(2,5-dimethylpiperazin-1-yl)but-2-en-1-one (PubChem CID 64980060) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is (E)-1-(2,5-dimethylpiperazin-1-yl)but-2-en-1-one.
| Compound Name | (E)-1-(2,5-dimethylpiperazin-1-yl)but-2-en-1-one |
|---|---|
| PubChem CID | 64980060 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | (E)-1-(2,5-dimethylpiperazin-1-yl)but-2-en-1-one |
| SMILES | C/C=C/C(=O)N1CC(C)NCC1C |
| InChI | InChI=1S/C10H18N2O/c1-4-5-10(13)12-7-8(2)11-6-9(12)3/h4-5,8-9,11H,6-7H2,1-3H3/b5-4+ |
| InChIKey | MYNCJEGMIMSEAK-SNAWJCMRSA-N |
| XLogP | 0.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|