C14H20IN3O — CID 64980495
2-(2,5-dimethylpiperazin-1-yl)-N-(2-iodophenyl)acetamide (PubChem CID 64980495) has the molecular formula C14H20IN3O and a molecular weight of 373.24 g/mol. Its IUPAC name is 2-(2,5-dimethylpiperazin-1-yl)-N-(2-iodophenyl)acetamide.
| Compound Name | 2-(2,5-dimethylpiperazin-1-yl)-N-(2-iodophenyl)acetamide |
|---|---|
| PubChem CID | 64980495 |
| Molecular Formula | C14H20IN3O |
| Molecular Weight | 373.24 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 2-(2,5-dimethylpiperazin-1-yl)-N-(2-iodophenyl)acetamide |
| SMILES | CC1CN(CC(=O)Nc2ccccc2I)C(C)CN1 |
| InChI | InChI=1S/C14H20IN3O/c1-10-8-18(11(2)7-16-10)9-14(19)17-13-6-4-3-5-12(13)15/h3-6,10-11,16H,7-9H2,1-2H3,(H,17,19) |
| InChIKey | FNFLUBIIIVBOOH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.24 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|