About (5-cyclopropyl-1,3,4-thiadiazol-2-yl)methanamine
(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methanamine (PubChem CID 64982598) has the molecular formula C6H9N3S
and a molecular weight of 155.23 g/mol. Its IUPAC name is (5-cyclopropyl-1,3,4-thiadiazol-2-yl)methanamine.
Analyze (5-cyclopropyl-1,3,4-thiadiazol-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-cyclopropyl-1,3,4-thiadiazol-2-yl)methanamine?
The IUPAC name of (5-cyclopropyl-1,3,4-thiadiazol-2-yl)methanamine (CID 64982598) is (5-cyclopropyl-1,3,4-thiadiazol-2-yl)methanamine.
What is the SMILES notation for (5-cyclopropyl-1,3,4-thiadiazol-2-yl)methanamine?
The canonical SMILES for (5-cyclopropyl-1,3,4-thiadiazol-2-yl)methanamine is NCc1nnc(C2CC2)s1.
What is the InChIKey of (5-cyclopropyl-1,3,4-thiadiazol-2-yl)methanamine?
The InChIKey is WLAIOTMIXQNEST-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3S/c7-3-5-8-9-6(10-5)4-1-2-4/h4H,1-3,7H2.
What are the key properties of (5-cyclopropyl-1,3,4-thiadiazol-2-yl)methanamine?
(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methanamine has a molecular weight of 155.23 g/mol, XLogP of 0.87, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-cyclopropyl-1,3,4-thiadiazol-2-yl)methanamine is sourced from PubChem (CID 64982598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).