About (5-ethyl-1,3,4-thiadiazol-2-yl)methanamine;hydrochloride
(5-ethyl-1,3,4-thiadiazol-2-yl)methanamine;hydrochloride (PubChem CID 50998533) has the molecular formula C5H10ClN3S
and a molecular weight of 179.68 g/mol. Its IUPAC name is (5-ethyl-1,3,4-thiadiazol-2-yl)methanamine;hydrochloride.
Molecular Properties
| Compound Name | (5-ethyl-1,3,4-thiadiazol-2-yl)methanamine;hydrochloride |
| PubChem CID | 50998533 |
| Molecular Formula | C5H10ClN3S |
| Molecular Weight | 179.68 g/mol |
| Exact Mass | 179.03 |
| IUPAC Name | (5-ethyl-1,3,4-thiadiazol-2-yl)methanamine;hydrochloride |
| SMILES | CCc1nnc(CN)s1.Cl |
| InChI | InChI=1S/C5H9N3S.ClH/c1-2-4-7-8-5(3-6)9-4;/h2-3,6H2,1H3;1H |
| InChIKey | RPAUQWMGQNPJIA-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.68 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-ethyl-1,3,4-thiadiazol-2-yl)methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-ethyl-1,3,4-thiadiazol-2-yl)methanamine;hydrochloride?
The IUPAC name of (5-ethyl-1,3,4-thiadiazol-2-yl)methanamine;hydrochloride (CID 50998533) is (5-ethyl-1,3,4-thiadiazol-2-yl)methanamine;hydrochloride.
What is the SMILES notation for (5-ethyl-1,3,4-thiadiazol-2-yl)methanamine;hydrochloride?
The canonical SMILES for (5-ethyl-1,3,4-thiadiazol-2-yl)methanamine;hydrochloride is CCc1nnc(CN)s1.Cl.
What is the InChIKey of (5-ethyl-1,3,4-thiadiazol-2-yl)methanamine;hydrochloride?
The InChIKey is RPAUQWMGQNPJIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3S.ClH/c1-2-4-7-8-5(3-6)9-4;/h2-3,6H2,1H3;1H.
What are the key properties of (5-ethyl-1,3,4-thiadiazol-2-yl)methanamine;hydrochloride?
(5-ethyl-1,3,4-thiadiazol-2-yl)methanamine;hydrochloride has a molecular weight of 179.68 g/mol, XLogP of 0.98, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-ethyl-1,3,4-thiadiazol-2-yl)methanamine;hydrochloride is sourced from PubChem (CID 50998533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).