C10H10N2O2 — CID 64983046
5-(2-methoxyphenyl)-1,2-oxazol-3-amine (PubChem CID 64983046) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 5-(2-methoxyphenyl)-1,2-oxazol-3-amine.
| Compound Name | 5-(2-methoxyphenyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 64983046 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 5-(2-methoxyphenyl)-1,2-oxazol-3-amine |
| SMILES | COc1ccccc1-c1cc(N)no1 |
| InChI | InChI=1S/C10H10N2O2/c1-13-8-5-3-2-4-7(8)9-6-10(11)12-14-9/h2-6H,1H3,(H2,11,12) |
| InChIKey | AHJCODOCVBPPEE-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |