C14H7F4N3 — CID 64983363
7-fluoro-2-(3,4,5-trifluorophenyl)quinazolin-4-amine (PubChem CID 64983363) has the molecular formula C14H7F4N3 and a molecular weight of 293.22 g/mol. Its IUPAC name is 7-fluoro-2-(3,4,5-trifluorophenyl)quinazolin-4-amine.
| Compound Name | 7-fluoro-2-(3,4,5-trifluorophenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 64983363 |
| Molecular Formula | C14H7F4N3 |
| Molecular Weight | 293.22 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 7-fluoro-2-(3,4,5-trifluorophenyl)quinazolin-4-amine |
| SMILES | Nc1nc(-c2cc(F)c(F)c(F)c2)nc2cc(F)ccc12 |
| InChI | InChI=1S/C14H7F4N3/c15-7-1-2-8-11(5-7)20-14(21-13(8)19)6-3-9(16)12(18)10(17)4-6/h1-5H,(H2,19,20,21) |
| InChIKey | AJKLYTCEXUKUOF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.22 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|