About 7-fluoro-2-(3,4,5-trifluorophenyl)quinazolin-4-amine
7-fluoro-2-(3,4,5-trifluorophenyl)quinazolin-4-amine (PubChem CID 64983363) has the molecular formula C14H7F4N3
and a molecular weight of 293.22 g/mol. Its IUPAC name is 7-fluoro-2-(3,4,5-trifluorophenyl)quinazolin-4-amine.
Molecular Properties
| Compound Name | 7-fluoro-2-(3,4,5-trifluorophenyl)quinazolin-4-amine |
| PubChem CID | 64983363 |
| Molecular Formula | C14H7F4N3 |
| Molecular Weight | 293.22 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 7-fluoro-2-(3,4,5-trifluorophenyl)quinazolin-4-amine |
| SMILES | Nc1nc(-c2cc(F)c(F)c(F)c2)nc2cc(F)ccc12 |
| InChI | InChI=1S/C14H7F4N3/c15-7-1-2-8-11(5-7)20-14(21-13(8)19)6-3-9(16)12(18)10(17)4-6/h1-5H,(H2,19,20,21) |
| InChIKey | AJKLYTCEXUKUOF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.22 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 7-fluoro-2-(3,4,5-trifluorophenyl)quinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-2-(3,4,5-trifluorophenyl)quinazolin-4-amine?
The IUPAC name of 7-fluoro-2-(3,4,5-trifluorophenyl)quinazolin-4-amine (CID 64983363) is 7-fluoro-2-(3,4,5-trifluorophenyl)quinazolin-4-amine.
What is the SMILES notation for 7-fluoro-2-(3,4,5-trifluorophenyl)quinazolin-4-amine?
The canonical SMILES for 7-fluoro-2-(3,4,5-trifluorophenyl)quinazolin-4-amine is Nc1nc(-c2cc(F)c(F)c(F)c2)nc2cc(F)ccc12.
What is the InChIKey of 7-fluoro-2-(3,4,5-trifluorophenyl)quinazolin-4-amine?
The InChIKey is AJKLYTCEXUKUOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7F4N3/c15-7-1-2-8-11(5-7)20-14(21-13(8)19)6-3-9(16)12(18)10(17)4-6/h1-5H,(H2,19,20,21).
What are the key properties of 7-fluoro-2-(3,4,5-trifluorophenyl)quinazolin-4-amine?
7-fluoro-2-(3,4,5-trifluorophenyl)quinazolin-4-amine has a molecular weight of 293.22 g/mol, XLogP of 3.44, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-2-(3,4,5-trifluorophenyl)quinazolin-4-amine is sourced from PubChem (CID 64983363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).