C16H14FN3 — CID 64983880
2-(2,5-dimethylphenyl)-7-fluoroquinazolin-4-amine (PubChem CID 64983880) has the molecular formula C16H14FN3 and a molecular weight of 267.31 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-7-fluoroquinazolin-4-amine.
| Compound Name | 2-(2,5-dimethylphenyl)-7-fluoroquinazolin-4-amine |
|---|---|
| PubChem CID | 64983880 |
| Molecular Formula | C16H14FN3 |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-7-fluoroquinazolin-4-amine |
| SMILES | Cc1ccc(C)c(-c2nc(N)c3ccc(F)cc3n2)c1 |
| InChI | InChI=1S/C16H14FN3/c1-9-3-4-10(2)13(7-9)16-19-14-8-11(17)5-6-12(14)15(18)20-16/h3-8H,1-2H3,(H2,18,19,20) |
| InChIKey | QTEDBCLVDXHUFS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |