C10H10F2N2O2 — CID 64986088
2-cyclobutyl-4-(difluoromethyl)pyrimidine-5-carboxylic acid (PubChem CID 64986088) has the molecular formula C10H10F2N2O2 and a molecular weight of 228.20 g/mol. Its IUPAC name is 2-cyclobutyl-4-(difluoromethyl)pyrimidine-5-carboxylic acid.
| Compound Name | 2-cyclobutyl-4-(difluoromethyl)pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 64986088 |
| Molecular Formula | C10H10F2N2O2 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 2-cyclobutyl-4-(difluoromethyl)pyrimidine-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(C2CCC2)nc1C(F)F |
| InChI | InChI=1S/C10H10F2N2O2/c11-8(12)7-6(10(15)16)4-13-9(14-7)5-2-1-3-5/h4-5,8H,1-3H2,(H,15,16) |
| InChIKey | BYNZOKJGIMPTCN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |