C18H21N3O3 — CID 6498628
6-methyl-N-[2-[[2-(4-methylphenoxy)acetyl]amino]ethyl]pyridine-3-carboxamide (PubChem CID 6498628) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 6-methyl-N-[2-[[2-(4-methylphenoxy)acetyl]amino]ethyl]pyridine-3-carboxamide.
| Compound Name | 6-methyl-N-[2-[[2-(4-methylphenoxy)acetyl]amino]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 6498628 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 6-methyl-N-[2-[[2-(4-methylphenoxy)acetyl]amino]ethyl]pyridine-3-carboxamide |
| SMILES | Cc1ccc(OCC(=O)NCCNC(=O)c2ccc(C)nc2)cc1 |
| InChI | InChI=1S/C18H21N3O3/c1-13-3-7-16(8-4-13)24-12-17(22)19-9-10-20-18(23)15-6-5-14(2)21-11-15/h3-8,11H,9-10,12H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | HABFKPVOXBLXQS-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|