C17H18ClN3O2 — CID 8990920
N-[2-[[2-(4-chlorophenyl)acetyl]amino]ethyl]-6-methylpyridine-3-carboxamide (PubChem CID 8990920) has the molecular formula C17H18ClN3O2 and a molecular weight of 331.80 g/mol. Its IUPAC name is N-[2-[[2-(4-chlorophenyl)acetyl]amino]ethyl]-6-methylpyridine-3-carboxamide.
| Compound Name | N-[2-[[2-(4-chlorophenyl)acetyl]amino]ethyl]-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 8990920 |
| Molecular Formula | C17H18ClN3O2 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | N-[2-[[2-(4-chlorophenyl)acetyl]amino]ethyl]-6-methylpyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)NCCNC(=O)Cc2ccc(Cl)cc2)cn1 |
| InChI | InChI=1S/C17H18ClN3O2/c1-12-2-5-14(11-21-12)17(23)20-9-8-19-16(22)10-13-3-6-15(18)7-4-13/h2-7,11H,8-10H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | CHEXRDXXJIIYMV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|