C8H16N2O2S2 — CID 64987502
2-[cyclopropylmethylsulfonyl(ethyl)amino]ethanethioamide (PubChem CID 64987502) has the molecular formula C8H16N2O2S2 and a molecular weight of 236.36 g/mol. Its IUPAC name is 2-[cyclopropylmethylsulfonyl(ethyl)amino]ethanethioamide.
| Compound Name | 2-[cyclopropylmethylsulfonyl(ethyl)amino]ethanethioamide |
|---|---|
| PubChem CID | 64987502 |
| Molecular Formula | C8H16N2O2S2 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 2-[cyclopropylmethylsulfonyl(ethyl)amino]ethanethioamide |
| SMILES | CCN(CC(N)=S)S(=O)(=O)CC1CC1 |
| InChI | InChI=1S/C8H16N2O2S2/c1-2-10(5-8(9)13)14(11,12)6-7-3-4-7/h7H,2-6H2,1H3,(H2,9,13) |
| InChIKey | MCABRMSTRUTACN-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|