C12H21N3S — CID 64990466
1-[1-[1-(1,3-thiazol-2-yl)ethyl]piperidin-2-yl]ethanamine (PubChem CID 64990466) has the molecular formula C12H21N3S and a molecular weight of 239.39 g/mol. Its IUPAC name is 1-[1-[1-(1,3-thiazol-2-yl)ethyl]piperidin-2-yl]ethanamine.
| Compound Name | 1-[1-[1-(1,3-thiazol-2-yl)ethyl]piperidin-2-yl]ethanamine |
|---|---|
| PubChem CID | 64990466 |
| Molecular Formula | C12H21N3S |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 1-[1-[1-(1,3-thiazol-2-yl)ethyl]piperidin-2-yl]ethanamine |
| SMILES | CC(N)C1CCCCN1C(C)c1nccs1 |
| InChI | InChI=1S/C12H21N3S/c1-9(13)11-5-3-4-7-15(11)10(2)12-14-6-8-16-12/h6,8-11H,3-5,7,13H2,1-2H3 |
| InChIKey | ODNUOGTUQONWPT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |