C11H13BrF2O — CID 64995343
4-[2-(bromomethyl)butoxy]-1,2-difluorobenzene (PubChem CID 64995343) has the molecular formula C11H13BrF2O and a molecular weight of 279.12 g/mol. Its IUPAC name is 4-[2-(bromomethyl)butoxy]-1,2-difluorobenzene.
| Compound Name | 4-[2-(bromomethyl)butoxy]-1,2-difluorobenzene |
|---|---|
| PubChem CID | 64995343 |
| Molecular Formula | C11H13BrF2O |
| Molecular Weight | 279.12 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | 4-[2-(bromomethyl)butoxy]-1,2-difluorobenzene |
| SMILES | CCC(CBr)COc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H13BrF2O/c1-2-8(6-12)7-15-9-3-4-10(13)11(14)5-9/h3-5,8H,2,6-7H2,1H3 |
| InChIKey | DKBSWJRVFLZUMW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.12 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|