C11H16ClF2NO — CID 86262544
1-(3,4-difluorophenoxy)-3-methylbutan-2-amine;hydrochloride (PubChem CID 86262544) has the molecular formula C11H16ClF2NO and a molecular weight of 251.70 g/mol. Its IUPAC name is 1-(3,4-difluorophenoxy)-3-methylbutan-2-amine;hydrochloride.
| Compound Name | 1-(3,4-difluorophenoxy)-3-methylbutan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 86262544 |
| Molecular Formula | C11H16ClF2NO |
| Molecular Weight | 251.70 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 1-(3,4-difluorophenoxy)-3-methylbutan-2-amine;hydrochloride |
| SMILES | CC(C)C(N)COc1ccc(F)c(F)c1.Cl |
| InChI | InChI=1S/C11H15F2NO.ClH/c1-7(2)11(14)6-15-8-3-4-9(12)10(13)5-8;/h3-5,7,11H,6,14H2,1-2H3;1H |
| InChIKey | FPDITBILCHTPED-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.70 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |