C13H27NO3S — CID 64999379
3-(2-ethylcyclohexyl)oxy-2,2-dimethylpropane-1-sulfonamide (PubChem CID 64999379) has the molecular formula C13H27NO3S and a molecular weight of 277.43 g/mol. Its IUPAC name is 3-(2-ethylcyclohexyl)oxy-2,2-dimethylpropane-1-sulfonamide.
| Compound Name | 3-(2-ethylcyclohexyl)oxy-2,2-dimethylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 64999379 |
| Molecular Formula | C13H27NO3S |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 3-(2-ethylcyclohexyl)oxy-2,2-dimethylpropane-1-sulfonamide |
| SMILES | CCC1CCCCC1OCC(C)(C)CS(N)(=O)=O |
| InChI | InChI=1S/C13H27NO3S/c1-4-11-7-5-6-8-12(11)17-9-13(2,3)10-18(14,15)16/h11-12H,4-10H2,1-3H3,(H2,14,15,16) |
| InChIKey | ZIEXAGROXLUTOE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |