C14H21ClO3S — CID 64999671
2,2-dimethyl-3-(3-phenylpropoxy)propane-1-sulfonyl chloride (PubChem CID 64999671) has the molecular formula C14H21ClO3S and a molecular weight of 304.84 g/mol. Its IUPAC name is 2,2-dimethyl-3-(3-phenylpropoxy)propane-1-sulfonyl chloride.
| Compound Name | 2,2-dimethyl-3-(3-phenylpropoxy)propane-1-sulfonyl chloride |
|---|---|
| PubChem CID | 64999671 |
| Molecular Formula | C14H21ClO3S |
| Molecular Weight | 304.84 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 2,2-dimethyl-3-(3-phenylpropoxy)propane-1-sulfonyl chloride |
| SMILES | CC(C)(COCCCc1ccccc1)CS(=O)(=O)Cl |
| InChI | InChI=1S/C14H21ClO3S/c1-14(2,12-19(15,16)17)11-18-10-6-9-13-7-4-3-5-8-13/h3-5,7-8H,6,9-12H2,1-2H3 |
| InChIKey | FSVBBEQPWSYPMJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.84 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|